C15H15BrO2 — CID 144668976
[(2E)-2-ethenylpenta-2,4-dienyl] 2-bromo-2-phenylacetate (PubChem CID 144668976) has the molecular formula C15H15BrO2 and a molecular weight of 307.19 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 2-bromo-2-phenylacetate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2-bromo-2-phenylacetate |
|---|---|
| PubChem CID | 144668976 |
| Molecular Formula | C15H15BrO2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.03 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 2-bromo-2-phenylacetate |
| SMILES | C=C/C=C(\C=C)COC(=O)C(Br)c1ccccc1 |
| InChI | InChI=1S/C15H15BrO2/c1-3-8-12(4-2)11-18-15(17)14(16)13-9-6-5-7-10-13/h3-10,14H,1-2,11H2/b12-8+ |
| InChIKey | VVLMIRYSHJLNRN-XYOKQWHBSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|