C20H26O3 — CID 145191994
[(2E)-2-ethenylpenta-2,4-dienyl] 3-(4-tert-butylphenyl)-2-hydroxypropanoate (PubChem CID 145191994) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is [(2E)-2-ethenylpenta-2,4-dienyl] 3-(4-tert-butylphenyl)-2-hydroxypropanoate.
| Compound Name | [(2E)-2-ethenylpenta-2,4-dienyl] 3-(4-tert-butylphenyl)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 145191994 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | [(2E)-2-ethenylpenta-2,4-dienyl] 3-(4-tert-butylphenyl)-2-hydroxypropanoate |
| SMILES | C=C/C=C(\C=C)COC(=O)C(O)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H26O3/c1-6-8-15(7-2)14-23-19(22)18(21)13-16-9-11-17(12-10-16)20(3,4)5/h6-12,18,21H,1-2,13-14H2,3-5H3/b15-8+ |
| InChIKey | VDTQUEBFPXTZLQ-OVCLIPMQSA-N |
| XLogP | 3.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|