C16H23NO3 — CID 102042910
prop-2-enyl (2S)-3-(4-tert-butylphenyl)-2-(hydroxyamino)propanoate (PubChem CID 102042910) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is prop-2-enyl (2S)-3-(4-tert-butylphenyl)-2-(hydroxyamino)propanoate.
| Compound Name | prop-2-enyl (2S)-3-(4-tert-butylphenyl)-2-(hydroxyamino)propanoate |
|---|---|
| PubChem CID | 102042910 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | prop-2-enyl (2S)-3-(4-tert-butylphenyl)-2-(hydroxyamino)propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(C(C)(C)C)cc1)NO |
| InChI | InChI=1S/C16H23NO3/c1-5-10-20-15(18)14(17-19)11-12-6-8-13(9-7-12)16(2,3)4/h5-9,14,17,19H,1,10-11H2,2-4H3/t14-/m0/s1 |
| InChIKey | GVHIWYZORKMUOV-AWEZNQCLSA-N |
| XLogP | 2.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|