C14H14BrCl2NO3 — CID 11223170
prop-2-enyl (2R)-3-(4-bromophenyl)-2-[(2,2-dichloroacetyl)amino]propanoate (PubChem CID 11223170) has the molecular formula C14H14BrCl2NO3 and a molecular weight of 395.08 g/mol. Its IUPAC name is prop-2-enyl (2R)-3-(4-bromophenyl)-2-[(2,2-dichloroacetyl)amino]propanoate.
| Compound Name | prop-2-enyl (2R)-3-(4-bromophenyl)-2-[(2,2-dichloroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 11223170 |
| Molecular Formula | C14H14BrCl2NO3 |
| Molecular Weight | 395.08 g/mol |
| Exact Mass | 392.95 |
| IUPAC Name | prop-2-enyl (2R)-3-(4-bromophenyl)-2-[(2,2-dichloroacetyl)amino]propanoate |
| SMILES | C=CCOC(=O)[C@@H](Cc1ccc(Br)cc1)NC(=O)C(Cl)Cl |
| InChI | InChI=1S/C14H14BrCl2NO3/c1-2-7-21-14(20)11(18-13(19)12(16)17)8-9-3-5-10(15)6-4-9/h2-6,11-12H,1,7-8H2,(H,18,19)/t11-/m1/s1 |
| InChIKey | XEJAYNZZMUORJW-LLVKDONJSA-N |
| XLogP | 3.01 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.08 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|