C14H16BrNO4 — CID 155817769
methyl (2S)-3-(4-bromophenyl)-2-(prop-2-enoxycarbonylamino)propanoate (PubChem CID 155817769) has the molecular formula C14H16BrNO4 and a molecular weight of 342.19 g/mol. Its IUPAC name is methyl (2S)-3-(4-bromophenyl)-2-(prop-2-enoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-(4-bromophenyl)-2-(prop-2-enoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 155817769 |
| Molecular Formula | C14H16BrNO4 |
| Molecular Weight | 342.19 g/mol |
| Exact Mass | 341.03 |
| IUPAC Name | methyl (2S)-3-(4-bromophenyl)-2-(prop-2-enoxycarbonylamino)propanoate |
| SMILES | C=CCOC(=O)N[C@@H](Cc1ccc(Br)cc1)C(=O)OC |
| InChI | InChI=1S/C14H16BrNO4/c1-3-8-20-14(18)16-12(13(17)19-2)9-10-4-6-11(15)7-5-10/h3-7,12H,1,8-9H2,2H3,(H,16,18)/t12-/m0/s1 |
| InChIKey | VODHJTQIADUAGN-LBPRGKRZSA-N |
| XLogP | 2.45 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|