C13H16BrNO4 — CID 123945198
methyl 3-(4-bromophenyl)-2-[(2-methoxyacetyl)amino]propanoate (PubChem CID 123945198) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is methyl 3-(4-bromophenyl)-2-[(2-methoxyacetyl)amino]propanoate.
| Compound Name | methyl 3-(4-bromophenyl)-2-[(2-methoxyacetyl)amino]propanoate |
|---|---|
| PubChem CID | 123945198 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | methyl 3-(4-bromophenyl)-2-[(2-methoxyacetyl)amino]propanoate |
| SMILES | COCC(=O)NC(Cc1ccc(Br)cc1)C(=O)OC |
| InChI | InChI=1S/C13H16BrNO4/c1-18-8-12(16)15-11(13(17)19-2)7-9-3-5-10(14)6-4-9/h3-6,11H,7-8H2,1-2H3,(H,15,16) |
| InChIKey | HUVGMKVJEVATGG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |