C15H19NO7 — CID 16719254
methyl 3-[4-(2-hydroxyacetyl)oxyphenyl]-2-[(2-methoxyacetyl)amino]propanoate (PubChem CID 16719254) has the molecular formula C15H19NO7 and a molecular weight of 325.32 g/mol. Its IUPAC name is methyl 3-[4-(2-hydroxyacetyl)oxyphenyl]-2-[(2-methoxyacetyl)amino]propanoate.
| Compound Name | methyl 3-[4-(2-hydroxyacetyl)oxyphenyl]-2-[(2-methoxyacetyl)amino]propanoate |
|---|---|
| PubChem CID | 16719254 |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | methyl 3-[4-(2-hydroxyacetyl)oxyphenyl]-2-[(2-methoxyacetyl)amino]propanoate |
| SMILES | COCC(=O)NC(Cc1ccc(OC(=O)CO)cc1)C(=O)OC |
| InChI | InChI=1S/C15H19NO7/c1-21-9-13(18)16-12(15(20)22-2)7-10-3-5-11(6-4-10)23-14(19)8-17/h3-6,12,17H,7-9H2,1-2H3,(H,16,18) |
| InChIKey | BAXDCIWTUKPUKO-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|