C22H25NO8 — CID 137423914
carbonic acid;prop-2-enyl 3-(4-hydroxyphenyl)-2-[3-(4-hydroxyphenyl)propanoylamino]propanoate (PubChem CID 137423914) has the molecular formula C22H25NO8 and a molecular weight of 431.44 g/mol. Its IUPAC name is carbonic acid;prop-2-enyl 3-(4-hydroxyphenyl)-2-[3-(4-hydroxyphenyl)propanoylamino]propanoate.
| Compound Name | carbonic acid;prop-2-enyl 3-(4-hydroxyphenyl)-2-[3-(4-hydroxyphenyl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 137423914 |
| Molecular Formula | C22H25NO8 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | carbonic acid;prop-2-enyl 3-(4-hydroxyphenyl)-2-[3-(4-hydroxyphenyl)propanoylamino]propanoate |
| SMILES | C=CCOC(=O)C(Cc1ccc(O)cc1)NC(=O)CCc1ccc(O)cc1.O=C(O)O |
| InChI | InChI=1S/C21H23NO5.CH2O3/c1-2-13-27-21(26)19(14-16-5-10-18(24)11-6-16)22-20(25)12-7-15-3-8-17(23)9-4-15;2-1(3)4/h2-6,8-11,19,23-24H,1,7,12-14H2,(H,22,25);(H2,2,3,4) |
| InChIKey | LUQCFZUJBPAUOS-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 153.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|