C18H24N2O4 — CID 10496804
prop-2-enyl (2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-hydroxyphenyl)propanoate (PubChem CID 10496804) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is prop-2-enyl (2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-hydroxyphenyl)propanoate.
| Compound Name | prop-2-enyl (2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 10496804 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | prop-2-enyl (2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-hydroxyphenyl)propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)C1(N)CCCC1 |
| InChI | InChI=1S/C18H24N2O4/c1-2-11-24-16(22)15(12-13-5-7-14(21)8-6-13)20-17(23)18(19)9-3-4-10-18/h2,5-8,15,21H,1,3-4,9-12,19H2,(H,20,23)/t15-/m0/s1 |
| InChIKey | GXXXGAKGRGZPJV-HNNXBMFYSA-N |
| XLogP | 1.42 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|