C22H27F3N2O6 — CID 10299012
bis(prop-2-enyl) 2-[[(2S)-3-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoyl]amino]pentanedioate (PubChem CID 10299012) has the molecular formula C22H27F3N2O6 and a molecular weight of 472.46 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[[(2S)-3-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoyl]amino]pentanedioate.
| Compound Name | bis(prop-2-enyl) 2-[[(2S)-3-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 10299012 |
| Molecular Formula | C22H27F3N2O6 |
| Molecular Weight | 472.46 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | bis(prop-2-enyl) 2-[[(2S)-3-(4-hydroxyphenyl)-2-(2,2,2-trifluoroethylamino)propanoyl]amino]pentanedioate |
| SMILES | C=CCOC(=O)CCC(NC(=O)[C@H](Cc1ccc(O)cc1)NCC(F)(F)F)C(=O)OCC=C |
| InChI | InChI=1S/C22H27F3N2O6/c1-3-11-32-19(29)10-9-17(21(31)33-12-4-2)27-20(30)18(26-14-22(23,24)25)13-15-5-7-16(28)8-6-15/h3-8,17-18,26,28H,1-2,9-14H2,(H,27,30)/t17?,18-/m0/s1 |
| InChIKey | IWJWPAZDLLOAIO-ZVAWYAOSSA-N |
| XLogP | 2.18 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|