C25H36NO7S+ — CID 163789922
tert-butyl-[[4-[[(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]carbamoyloxy]phenyl]methoxy]-ethylsulfanium (PubChem CID 163789922) has the molecular formula C25H36NO7S+ and a molecular weight of 494.63 g/mol. Its IUPAC name is tert-butyl-[[4-[[(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]carbamoyloxy]phenyl]methoxy]-ethylsulfanium.
| Compound Name | tert-butyl-[[4-[[(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]carbamoyloxy]phenyl]methoxy]-ethylsulfanium |
|---|---|
| PubChem CID | 163789922 |
| Molecular Formula | C25H36NO7S+ |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | tert-butyl-[[4-[[(2S)-1,5-dioxo-1,5-bis(prop-2-enoxy)pentan-2-yl]carbamoyloxy]phenyl]methoxy]-ethylsulfanium |
| SMILES | C=CCOC(=O)CC[C@H](NC(=O)Oc1ccc(CO[S+](CC)C(C)(C)C)cc1)C(=O)OCC=C |
| InChI | InChI=1S/C25H35NO7S/c1-7-16-30-22(27)15-14-21(23(28)31-17-8-2)26-24(29)33-20-12-10-19(11-13-20)18-32-34(9-3)25(4,5)6/h7-8,10-13,21H,1-2,9,14-18H2,3-6H3/p+1/t21-,34?/m0/s1 |
| InChIKey | MVTZDWIPKIZVFV-WABSOPGISA-O |
| XLogP | 4.25 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|