C29H35O9P — CID 130310759
bis(prop-2-enyl) 2-[[(4-acetyloxyphenyl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methyl]pentanedioate (PubChem CID 130310759) has the molecular formula C29H35O9P and a molecular weight of 558.56 g/mol. Its IUPAC name is bis(prop-2-enyl) 2-[[(4-acetyloxyphenyl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methyl]pentanedioate.
| Compound Name | bis(prop-2-enyl) 2-[[(4-acetyloxyphenyl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methyl]pentanedioate |
|---|---|
| PubChem CID | 130310759 |
| Molecular Formula | C29H35O9P |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | bis(prop-2-enyl) 2-[[(4-acetyloxyphenyl)methoxy-[(4-methylphenyl)methoxy]phosphoryl]methyl]pentanedioate |
| SMILES | C=CCOC(=O)CCC(CP(=O)(OCc1ccc(C)cc1)OCc1ccc(OC(C)=O)cc1)C(=O)OCC=C |
| InChI | InChI=1S/C29H35O9P/c1-5-17-34-28(31)16-13-26(29(32)35-18-6-2)21-39(33,36-19-24-9-7-22(3)8-10-24)37-20-25-11-14-27(15-12-25)38-23(4)30/h5-12,14-15,26H,1-2,13,16-21H2,3-4H3 |
| InChIKey | AEVIGKQGNXQNPA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|