C14H17NO5 — CID 138627874
prop-2-enyl 3-[4-(hydroxymethylcarbamoyloxy)phenyl]propanoate (PubChem CID 138627874) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is prop-2-enyl 3-[4-(hydroxymethylcarbamoyloxy)phenyl]propanoate.
| Compound Name | prop-2-enyl 3-[4-(hydroxymethylcarbamoyloxy)phenyl]propanoate |
|---|---|
| PubChem CID | 138627874 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | prop-2-enyl 3-[4-(hydroxymethylcarbamoyloxy)phenyl]propanoate |
| SMILES | C=CCOC(=O)CCc1ccc(OC(=O)NCO)cc1 |
| InChI | InChI=1S/C14H17NO5/c1-2-9-19-13(17)8-5-11-3-6-12(7-4-11)20-14(18)15-10-16/h2-4,6-7,16H,1,5,8-10H2,(H,15,18) |
| InChIKey | OZNIEFMJJYZITI-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|