C21H29NO6 — CID 123362353
prop-2-enyl 5-[[2-[4-(hydroxymethyl)phenoxy]-2-oxoethyl]carbamoyl]-6-methylheptanoate (PubChem CID 123362353) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is prop-2-enyl 5-[[2-[4-(hydroxymethyl)phenoxy]-2-oxoethyl]carbamoyl]-6-methylheptanoate.
| Compound Name | prop-2-enyl 5-[[2-[4-(hydroxymethyl)phenoxy]-2-oxoethyl]carbamoyl]-6-methylheptanoate |
|---|---|
| PubChem CID | 123362353 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | prop-2-enyl 5-[[2-[4-(hydroxymethyl)phenoxy]-2-oxoethyl]carbamoyl]-6-methylheptanoate |
| SMILES | C=CCOC(=O)CCCC(C(=O)NCC(=O)Oc1ccc(CO)cc1)C(C)C |
| InChI | InChI=1S/C21H29NO6/c1-4-12-27-19(24)7-5-6-18(15(2)3)21(26)22-13-20(25)28-17-10-8-16(14-23)9-11-17/h4,8-11,15,18,23H,1,5-7,12-14H2,2-3H3,(H,22,26) |
| InChIKey | KIZLCRONGFSKQM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|