C25H37NO5 — CID 138503040
prop-2-enyl N-[(3S,8R)-12-[4-(hydroxymethyl)phenyl]-2,8-dimethyl-4,9-dioxododecan-3-yl]carbamate (PubChem CID 138503040) has the molecular formula C25H37NO5 and a molecular weight of 431.57 g/mol. Its IUPAC name is prop-2-enyl N-[(3S,8R)-12-[4-(hydroxymethyl)phenyl]-2,8-dimethyl-4,9-dioxododecan-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[(3S,8R)-12-[4-(hydroxymethyl)phenyl]-2,8-dimethyl-4,9-dioxododecan-3-yl]carbamate |
|---|---|
| PubChem CID | 138503040 |
| Molecular Formula | C25H37NO5 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.27 |
| IUPAC Name | prop-2-enyl N-[(3S,8R)-12-[4-(hydroxymethyl)phenyl]-2,8-dimethyl-4,9-dioxododecan-3-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@H](C(=O)CCC[C@@H](C)C(=O)CCCc1ccc(CO)cc1)C(C)C |
| InChI | InChI=1S/C25H37NO5/c1-5-16-31-25(30)26-24(18(2)3)23(29)11-6-8-19(4)22(28)10-7-9-20-12-14-21(17-27)15-13-20/h5,12-15,18-19,24,27H,1,6-11,16-17H2,2-4H3,(H,26,30)/t19-,24+/m1/s1 |
| InChIKey | MDLIFJSPMQPXCR-DVECYGJZSA-N |
| XLogP | 4.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|