C15H25NO5 — CID 123840908
2,8-dimethyl-6-oxo-7-(prop-2-enoxycarbonylamino)nonanoic acid (PubChem CID 123840908) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 2,8-dimethyl-6-oxo-7-(prop-2-enoxycarbonylamino)nonanoic acid.
| Compound Name | 2,8-dimethyl-6-oxo-7-(prop-2-enoxycarbonylamino)nonanoic acid |
|---|---|
| PubChem CID | 123840908 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2,8-dimethyl-6-oxo-7-(prop-2-enoxycarbonylamino)nonanoic acid |
| SMILES | C=CCOC(=O)NC(C(=O)CCCC(C)C(=O)O)C(C)C |
| InChI | InChI=1S/C15H25NO5/c1-5-9-21-15(20)16-13(10(2)3)12(17)8-6-7-11(4)14(18)19/h5,10-11,13H,1,6-9H2,2-4H3,(H,16,20)(H,18,19) |
| InChIKey | LRKGVRVMZKEEHA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|