C13H22N2O6 — CID 175971528
(2R)-3-hydroxy-2-[[(2R)-3-methyl-2-(prop-2-enoxycarbonylamino)pentanoyl]amino]propanoic acid (PubChem CID 175971528) has the molecular formula C13H22N2O6 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-3-hydroxy-2-[[(2R)-3-methyl-2-(prop-2-enoxycarbonylamino)pentanoyl]amino]propanoic acid.
| Compound Name | (2R)-3-hydroxy-2-[[(2R)-3-methyl-2-(prop-2-enoxycarbonylamino)pentanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 175971528 |
| Molecular Formula | C13H22N2O6 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | (2R)-3-hydroxy-2-[[(2R)-3-methyl-2-(prop-2-enoxycarbonylamino)pentanoyl]amino]propanoic acid |
| SMILES | C=CCOC(=O)N[C@@H](C(=O)N[C@H](CO)C(=O)O)C(C)CC |
| InChI | InChI=1S/C13H22N2O6/c1-4-6-21-13(20)15-10(8(3)5-2)11(17)14-9(7-16)12(18)19/h4,8-10,16H,1,5-7H2,2-3H3,(H,14,17)(H,15,20)(H,18,19)/t8?,9-,10-/m1/s1 |
| InChIKey | YJKFCYJEACPOMF-VXRWAFEHSA-N |
| XLogP | -0.12 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|