C17H21NO6 — CID 19922227
5-hydroxy-4-oxo-7-phenyl-3-(prop-2-enoxycarbonylamino)heptanoic acid (PubChem CID 19922227) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 5-hydroxy-4-oxo-7-phenyl-3-(prop-2-enoxycarbonylamino)heptanoic acid.
| Compound Name | 5-hydroxy-4-oxo-7-phenyl-3-(prop-2-enoxycarbonylamino)heptanoic acid |
|---|---|
| PubChem CID | 19922227 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 5-hydroxy-4-oxo-7-phenyl-3-(prop-2-enoxycarbonylamino)heptanoic acid |
| SMILES | C=CCOC(=O)NC(CC(=O)O)C(=O)C(O)CCc1ccccc1 |
| InChI | InChI=1S/C17H21NO6/c1-2-10-24-17(23)18-13(11-15(20)21)16(22)14(19)9-8-12-6-4-3-5-7-12/h2-7,13-14,19H,1,8-11H2,(H,18,23)(H,20,21) |
| InChIKey | FAZRQYHPMCSECP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|