C17H24N2O5 — CID 142212831
4-(2-aminophenyl)-4-oxo-2-(prop-2-enoxycarbonylamino)butanoic acid;propane (PubChem CID 142212831) has the molecular formula C17H24N2O5 and a molecular weight of 336.39 g/mol. Its IUPAC name is 4-(2-aminophenyl)-4-oxo-2-(prop-2-enoxycarbonylamino)butanoic acid;propane.
| Compound Name | 4-(2-aminophenyl)-4-oxo-2-(prop-2-enoxycarbonylamino)butanoic acid;propane |
|---|---|
| PubChem CID | 142212831 |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 4-(2-aminophenyl)-4-oxo-2-(prop-2-enoxycarbonylamino)butanoic acid;propane |
| SMILES | C=CCOC(=O)NC(CC(=O)c1ccccc1N)C(=O)O.CCC |
| InChI | InChI=1S/C14H16N2O5.C3H8/c1-2-7-21-14(20)16-11(13(18)19)8-12(17)9-5-3-4-6-10(9)15;1-3-2/h2-6,11H,1,7-8,15H2,(H,16,20)(H,18,19);3H2,1-2H3 |
| InChIKey | FDLWJCGNGAYHEQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|