C18H18F3NO2 — CID 118356487
methyl (2S)-3-(4-phenylphenyl)-2-(2,2,2-trifluoroethylamino)propanoate (PubChem CID 118356487) has the molecular formula C18H18F3NO2 and a molecular weight of 337.34 g/mol. Its IUPAC name is methyl (2S)-3-(4-phenylphenyl)-2-(2,2,2-trifluoroethylamino)propanoate.
| Compound Name | methyl (2S)-3-(4-phenylphenyl)-2-(2,2,2-trifluoroethylamino)propanoate |
|---|---|
| PubChem CID | 118356487 |
| Molecular Formula | C18H18F3NO2 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | methyl (2S)-3-(4-phenylphenyl)-2-(2,2,2-trifluoroethylamino)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc(-c2ccccc2)cc1)NCC(F)(F)F |
| InChI | InChI=1S/C18H18F3NO2/c1-24-17(23)16(22-12-18(19,20)21)11-13-7-9-15(10-8-13)14-5-3-2-4-6-14/h2-10,16,22H,11-12H2,1H3/t16-/m0/s1 |
| InChIKey | PSYBRIIGGRBBOB-INIZCTEOSA-N |
| XLogP | 3.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |