C24H34N4O7 — CID 68614886
5-O-tert-butyl 1-O-methyl 2-[[(2S)-3-(4-carbamimidoylphenyl)-2-(prop-2-enoxycarbonylamino)propanoyl]amino]pentanedioate (PubChem CID 68614886) has the molecular formula C24H34N4O7 and a molecular weight of 490.56 g/mol. Its IUPAC name is 5-O-tert-butyl 1-O-methyl 2-[[(2S)-3-(4-carbamimidoylphenyl)-2-(prop-2-enoxycarbonylamino)propanoyl]amino]pentanedioate.
| Compound Name | 5-O-tert-butyl 1-O-methyl 2-[[(2S)-3-(4-carbamimidoylphenyl)-2-(prop-2-enoxycarbonylamino)propanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 68614886 |
| Molecular Formula | C24H34N4O7 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | 5-O-tert-butyl 1-O-methyl 2-[[(2S)-3-(4-carbamimidoylphenyl)-2-(prop-2-enoxycarbonylamino)propanoyl]amino]pentanedioate |
| SMILES | [H]/N=C(\N)c1ccc(C[C@H](NC(=O)OCC=C)C(=O)NC(CCC(=O)OC(C)(C)C)C(=O)OC)cc1 |
| InChI | InChI=1S/C24H34N4O7/c1-6-13-34-23(32)28-18(14-15-7-9-16(10-8-15)20(25)26)21(30)27-17(22(31)33-5)11-12-19(29)35-24(2,3)4/h6-10,17-18H,1,11-14H2,2-5H3,(H3,25,26)(H,27,30)(H,28,32)/t17?,18-/m0/s1 |
| InChIKey | SNKWUECKIPDBNO-ZVAWYAOSSA-N |
| XLogP | 1.57 |
| TPSA | 169.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|