C18H27N3O5 — CID 143283869
acetamide;methyl 3-(4-methanimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 143283869) has the molecular formula C18H27N3O5 and a molecular weight of 365.43 g/mol. Its IUPAC name is acetamide;methyl 3-(4-methanimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | acetamide;methyl 3-(4-methanimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 143283869 |
| Molecular Formula | C18H27N3O5 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | acetamide;methyl 3-(4-methanimidoylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | CC(N)=O.[H]/N=C/c1ccc(CC(NC(=O)OC(C)(C)C)C(=O)OC)cc1 |
| InChI | InChI=1S/C16H22N2O4.C2H5NO/c1-16(2,3)22-15(20)18-13(14(19)21-4)9-11-5-7-12(10-17)8-6-11;1-2(3)4/h5-8,10,13,17H,9H2,1-4H3,(H,18,20);1H3,(H2,3,4)/b17-10+; |
| InChIKey | GSDVNOIHPOHQLJ-LZMXEPDESA-N |
| XLogP | 1.78 |
| TPSA | 131.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|