C36H51N3O8 — CID 15017960
ditert-butyl (2S)-2-[[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]pentanedioate (PubChem CID 15017960) has the molecular formula C36H51N3O8 and a molecular weight of 653.82 g/mol. Its IUPAC name is ditert-butyl (2S)-2-[[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]pentanedioate.
| Compound Name | ditert-butyl (2S)-2-[[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 15017960 |
| Molecular Formula | C36H51N3O8 |
| Molecular Weight | 653.82 g/mol |
| Exact Mass | 653.37 |
| IUPAC Name | ditert-butyl (2S)-2-[[(2S)-4-methyl-2-[[(2S)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoyl]amino]pentanoyl]amino]pentanedioate |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)OCc1ccccc1)C(=O)N[C@@H](CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C36H51N3O8/c1-24(2)21-28(31(41)37-27(33(43)47-36(6,7)8)19-20-30(40)46-35(3,4)5)38-32(42)29(22-25-15-11-9-12-16-25)39-34(44)45-23-26-17-13-10-14-18-26/h9-18,24,27-29H,19-23H2,1-8H3,(H,37,41)(H,38,42)(H,39,44)/t27-,28-,29-/m0/s1 |
| InChIKey | ZUMJPWXNFLURLI-AWCRTANDSA-N |
| XLogP | 5.00 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.82 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|