C22H33N3O7 — CID 71275672
ditert-butyl (2S)-2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioate (PubChem CID 71275672) has the molecular formula C22H33N3O7 and a molecular weight of 451.52 g/mol. Its IUPAC name is ditert-butyl (2S)-2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioate.
| Compound Name | ditert-butyl (2S)-2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioate |
|---|---|
| PubChem CID | 71275672 |
| Molecular Formula | C22H33N3O7 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | ditert-butyl (2S)-2-(phenylmethoxycarbonylaminocarbamoylamino)pentanedioate |
| SMILES | CC(C)(C)OC(=O)CC[C@H](NC(=O)NNC(=O)OCc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H33N3O7/c1-21(2,3)31-17(26)13-12-16(18(27)32-22(4,5)6)23-19(28)24-25-20(29)30-14-15-10-8-7-9-11-15/h7-11,16H,12-14H2,1-6H3,(H,25,29)(H2,23,24,28)/t16-/m0/s1 |
| InChIKey | AMCDXFINDVIOAP-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 132.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|