C36H53N3O9 — CID 67934595
ditert-butyl 2-[(2-amino-4-methylpentanoyl)amino]pentanedioate;3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid (PubChem CID 67934595) has the molecular formula C36H53N3O9 and a molecular weight of 671.83 g/mol. Its IUPAC name is ditert-butyl 2-[(2-amino-4-methylpentanoyl)amino]pentanedioate;3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid.
| Compound Name | ditert-butyl 2-[(2-amino-4-methylpentanoyl)amino]pentanedioate;3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
|---|---|
| PubChem CID | 67934595 |
| Molecular Formula | C36H53N3O9 |
| Molecular Weight | 671.83 g/mol |
| Exact Mass | 671.38 |
| IUPAC Name | ditert-butyl 2-[(2-amino-4-methylpentanoyl)amino]pentanedioate;3-phenyl-2-(phenylmethoxycarbonylamino)propanoic acid |
| SMILES | CC(C)CC(N)C(=O)NC(CCC(=O)OC(C)(C)C)C(=O)OC(C)(C)C.O=C(NC(Cc1ccccc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H36N2O5.C17H17NO4/c1-12(2)11-13(20)16(23)21-14(17(24)26-19(6,7)8)9-10-15(22)25-18(3,4)5;19-16(20)15(11-13-7-3-1-4-8-13)18-17(21)22-12-14-9-5-2-6-10-14/h12-14H,9-11,20H2,1-8H3,(H,21,23);1-10,15H,11-12H2,(H,18,21)(H,19,20) |
| InChIKey | MXDJKDXEVHGIDZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 183.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.83 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|