C16H22N2O4 — CID 139663590
(2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-methoxyphenyl)propanoic acid (PubChem CID 139663590) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is (2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 139663590 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | (2S)-2-[(1-aminocyclopentanecarbonyl)amino]-3-(4-methoxyphenyl)propanoic acid |
| SMILES | COc1ccc(C[C@H](NC(=O)C2(N)CCCC2)C(=O)O)cc1 |
| InChI | InChI=1S/C16H22N2O4/c1-22-12-6-4-11(5-7-12)10-13(14(19)20)18-15(21)16(17)8-2-3-9-16/h4-7,13H,2-3,8-10,17H2,1H3,(H,18,21)(H,19,20)/t13-/m0/s1 |
| InChIKey | KTUWUBOYQHSSAU-ZDUSSCGKSA-N |
| XLogP | 1.08 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |