C18H25NO8 — CID 46867573
oxalic acid;prop-2-enyl (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 46867573) has the molecular formula C18H25NO8 and a molecular weight of 383.40 g/mol. Its IUPAC name is oxalic acid;prop-2-enyl (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | oxalic acid;prop-2-enyl (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 46867573 |
| Molecular Formula | C18H25NO8 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | oxalic acid;prop-2-enyl (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | C=CCOC(=O)[C@H](Cc1ccc(OC(C)(C)C)cc1)NO.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H23NO4.C2H2O4/c1-5-10-20-15(18)14(17-19)11-12-6-8-13(9-7-12)21-16(2,3)4;3-1(4)2(5)6/h5-9,14,17,19H,1,10-11H2,2-4H3;(H,3,4)(H,5,6)/t14-;/m0./s1 |
| InChIKey | RADSDIMYPXPFRG-UQKRIMTDSA-N |
| XLogP | 1.64 |
| TPSA | 142.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|