C18H27NO3 — CID 102467002
2-methylbut-3-en-2-yl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 102467002) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is 2-methylbut-3-en-2-yl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | 2-methylbut-3-en-2-yl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 102467002 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | 2-methylbut-3-en-2-yl (2S)-2-amino-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | C=CC(C)(C)OC(=O)[C@@H](N)Cc1ccc(OC(C)(C)C)cc1 |
| InChI | InChI=1S/C18H27NO3/c1-7-18(5,6)22-16(20)15(19)12-13-8-10-14(11-9-13)21-17(2,3)4/h7-11,15H,1,12,19H2,2-6H3/t15-/m0/s1 |
| InChIKey | KIFYBONJCWBWDV-HNNXBMFYSA-N |
| XLogP | 3.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|