C21H33NO4 — CID 58868039
tert-butyl N-[(2S,3R)-3-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]hex-5-en-2-yl]carbamate (PubChem CID 58868039) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is tert-butyl N-[(2S,3R)-3-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]hex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3R)-3-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 58868039 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | tert-butyl N-[(2S,3R)-3-hydroxy-1-[4-[(2-methylpropan-2-yl)oxy]phenyl]hex-5-en-2-yl]carbamate |
| SMILES | C=CC[C@@H](O)[C@H](Cc1ccc(OC(C)(C)C)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H33NO4/c1-8-9-18(23)17(22-19(24)26-21(5,6)7)14-15-10-12-16(13-11-15)25-20(2,3)4/h8,10-13,17-18,23H,1,9,14H2,2-7H3,(H,22,24)/t17-,18+/m0/s1 |
| InChIKey | LMQAKMCFGGUGCH-ZWKOTPCHSA-N |
| XLogP | 4.24 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|