C23H37NO4 — CID 68638918
tert-butyl N-[1-[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-hydroxyhex-5-en-2-yl]carbamate (PubChem CID 68638918) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is tert-butyl N-[1-[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-hydroxyhex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-hydroxyhex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 68638918 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | tert-butyl N-[1-[2,6-dimethyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-3-hydroxyhex-5-en-2-yl]carbamate |
| SMILES | C=CCC(O)C(Cc1c(C)cc(OC(C)(C)C)cc1C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H37NO4/c1-10-11-20(25)19(24-21(26)28-23(7,8)9)14-18-15(2)12-17(13-16(18)3)27-22(4,5)6/h10,12-13,19-20,25H,1,11,14H2,2-9H3,(H,24,26) |
| InChIKey | SXTNJHUSSPMCFZ-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|