C11H21NO3S — CID 89204455
tert-butyl N-[(3S)-1-hydroxy-2-sulfanylhex-5-en-3-yl]carbamate (PubChem CID 89204455) has the molecular formula C11H21NO3S and a molecular weight of 247.36 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-hydroxy-2-sulfanylhex-5-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-hydroxy-2-sulfanylhex-5-en-3-yl]carbamate |
|---|---|
| PubChem CID | 89204455 |
| Molecular Formula | C11H21NO3S |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | tert-butyl N-[(3S)-1-hydroxy-2-sulfanylhex-5-en-3-yl]carbamate |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)C(S)CO |
| InChI | InChI=1S/C11H21NO3S/c1-5-6-8(9(16)7-13)12-10(14)15-11(2,3)4/h5,8-9,13,16H,1,6-7H2,2-4H3,(H,12,14)/t8-,9?/m0/s1 |
| InChIKey | NHGMMGHXHZNVCG-IENPIDJESA-N |
| XLogP | 1.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|