C12H19NO6 — CID 18341300
(2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enylbutanedioic acid (PubChem CID 18341300) has the molecular formula C12H19NO6 and a molecular weight of 273.28 g/mol. Its IUPAC name is (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enylbutanedioic acid.
| Compound Name | (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enylbutanedioic acid |
|---|---|
| PubChem CID | 18341300 |
| Molecular Formula | C12H19NO6 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2R,3S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-prop-2-enylbutanedioic acid |
| SMILES | C=CC[C@H](C(=O)O)[C@@H](NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H19NO6/c1-5-6-7(9(14)15)8(10(16)17)13-11(18)19-12(2,3)4/h5,7-8H,1,6H2,2-4H3,(H,13,18)(H,14,15)(H,16,17)/t7-,8+/m0/s1 |
| InChIKey | DBWJHHWDBASYHE-JGVFFNPUSA-N |
| XLogP | 1.24 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|