C11H19NO5 — CID 130420470
(3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid (PubChem CID 130420470) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid.
| Compound Name | (3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid |
|---|---|
| PubChem CID | 130420470 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (3S)-2-hydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]hex-5-enoic acid |
| SMILES | C=CC[C@H](NC(=O)OC(C)(C)C)C(O)C(=O)O |
| InChI | InChI=1S/C11H19NO5/c1-5-6-7(8(13)9(14)15)12-10(16)17-11(2,3)4/h5,7-8,13H,1,6H2,2-4H3,(H,12,16)(H,14,15)/t7-,8?/m0/s1 |
| InChIKey | YCVRIOLIDRSHAB-JAMMHHFISA-N |
| XLogP | 0.90 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|