C34H37NO4 — CID 155022195
[(2-methylphenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 155022195) has the molecular formula C34H37NO4 and a molecular weight of 523.67 g/mol. Its IUPAC name is [(2-methylphenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | [(2-methylphenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 155022195 |
| Molecular Formula | C34H37NO4 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | [(2-methylphenyl)-(4-methylphenyl)-phenylmethyl] (2S)-2-(hydroxyamino)-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | Cc1ccc(C(OC(=O)[C@H](Cc2ccc(OC(C)(C)C)cc2)NO)(c2ccccc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C34H37NO4/c1-24-15-19-28(20-16-24)34(27-12-7-6-8-13-27,30-14-10-9-11-25(30)2)39-32(36)31(35-37)23-26-17-21-29(22-18-26)38-33(3,4)5/h6-22,31,35,37H,23H2,1-5H3/t31-,34?/m0/s1 |
| InChIKey | SQOJKPRCFGLWHV-PTYUOYDSSA-N |
| XLogP | 6.91 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|