C17H27NO4 — CID 143275907
ethane;methyl 2-formamido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate (PubChem CID 143275907) has the molecular formula C17H27NO4 and a molecular weight of 309.41 g/mol. Its IUPAC name is ethane;methyl 2-formamido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate.
| Compound Name | ethane;methyl 2-formamido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
|---|---|
| PubChem CID | 143275907 |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.19 |
| IUPAC Name | ethane;methyl 2-formamido-3-[4-[(2-methylpropan-2-yl)oxy]phenyl]propanoate |
| SMILES | CC.COC(=O)C(Cc1ccc(OC(C)(C)C)cc1)NC=O |
| InChI | InChI=1S/C15H21NO4.C2H6/c1-15(2,3)20-12-7-5-11(6-8-12)9-13(16-10-17)14(18)19-4;1-2/h5-8,10,13H,9H2,1-4H3,(H,16,17);1-2H3 |
| InChIKey | NMVXJBJFPLSEAZ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|