C15H16N2O3 — CID 13021406
methyl 2-formamido-3-(4-pyrrol-1-ylphenyl)propanoate (PubChem CID 13021406) has the molecular formula C15H16N2O3 and a molecular weight of 272.30 g/mol. Its IUPAC name is methyl 2-formamido-3-(4-pyrrol-1-ylphenyl)propanoate.
| Compound Name | methyl 2-formamido-3-(4-pyrrol-1-ylphenyl)propanoate |
|---|---|
| PubChem CID | 13021406 |
| Molecular Formula | C15H16N2O3 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | methyl 2-formamido-3-(4-pyrrol-1-ylphenyl)propanoate |
| SMILES | COC(=O)C(Cc1ccc(-n2cccc2)cc1)NC=O |
| InChI | InChI=1S/C15H16N2O3/c1-20-15(19)14(16-11-18)10-12-4-6-13(7-5-12)17-8-2-3-9-17/h2-9,11,14H,10H2,1H3,(H,16,18) |
| InChIKey | NQZQYDHTGAVWTE-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|