C11H12N2O5 — CID 23458865
methyl 2-formamido-3-(3-nitrophenyl)propanoate (PubChem CID 23458865) has the molecular formula C11H12N2O5 and a molecular weight of 252.23 g/mol. Its IUPAC name is methyl 2-formamido-3-(3-nitrophenyl)propanoate.
| Compound Name | methyl 2-formamido-3-(3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 23458865 |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | methyl 2-formamido-3-(3-nitrophenyl)propanoate |
| SMILES | COC(=O)C(Cc1cccc([N+](=O)[O-])c1)NC=O |
| InChI | InChI=1S/C11H12N2O5/c1-18-11(15)10(12-7-14)6-8-3-2-4-9(5-8)13(16)17/h2-5,7,10H,6H2,1H3,(H,12,14) |
| InChIKey | IOZJLOGMUNYNEA-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|