About benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride
benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride (PubChem CID 174370721) has the molecular formula C23H23ClN2O5
and a molecular weight of 442.90 g/mol. Its IUPAC name is benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride.
Molecular Properties
| Compound Name | benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride |
| PubChem CID | 174370721 |
| Molecular Formula | C23H23ClN2O5 |
| Molecular Weight | 442.90 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride |
| SMILES | COc1ccc(NC(Cc2cccc([N+](=O)[O-])c2)C(=O)OCc2ccccc2)cc1.Cl |
| InChI | InChI=1S/C23H22N2O5.ClH/c1-29-21-12-10-19(11-13-21)24-22(15-18-8-5-9-20(14-18)25(27)28)23(26)30-16-17-6-3-2-4-7-17;/h2-14,22,24H,15-16H2,1H3;1H |
| InChIKey | ZUXRNVLTXCFJII-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.90 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride?
The IUPAC name of benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride (CID 174370721) is benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride.
What is the SMILES notation for benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride?
The canonical SMILES for benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride is COc1ccc(NC(Cc2cccc([N+](=O)[O-])c2)C(=O)OCc2ccccc2)cc1.Cl.
What is the InChIKey of benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride?
The InChIKey is ZUXRNVLTXCFJII-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O5.ClH/c1-29-21-12-10-19(11-13-21)24-22(15-18-8-5-9-20(14-18)25(27)28)23(26)30-16-17-6-3-2-4-7-17;/h2-14,22,24H,15-16H2,1H3;1H.
What are the key properties of benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride?
benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride has a molecular weight of 442.90 g/mol, XLogP of 4.79, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl 2-(4-methoxyanilino)-3-(3-nitrophenyl)propanoate;hydrochloride is sourced from PubChem (CID 174370721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).