C15H20N2O5 — CID 142107027
[4-(3-amino-2-formamido-3-oxopropyl)phenyl] tert-butyl carbonate (PubChem CID 142107027) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is [4-(3-amino-2-formamido-3-oxopropyl)phenyl] tert-butyl carbonate.
| Compound Name | [4-(3-amino-2-formamido-3-oxopropyl)phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 142107027 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-(3-amino-2-formamido-3-oxopropyl)phenyl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(CC(NC=O)C(N)=O)cc1 |
| InChI | InChI=1S/C15H20N2O5/c1-15(2,3)22-14(20)21-11-6-4-10(5-7-11)8-12(13(16)19)17-9-18/h4-7,9,12H,8H2,1-3H3,(H2,16,19)(H,17,18) |
| InChIKey | IINMVSBKXWDALR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|