About tert-butyl (4-butylphenyl) carbonate
tert-butyl (4-butylphenyl) carbonate (PubChem CID 22625486) has the molecular formula C15H22O3
and a molecular weight of 250.34 g/mol. Its IUPAC name is tert-butyl (4-butylphenyl) carbonate.
Molecular Properties
| Compound Name | tert-butyl (4-butylphenyl) carbonate |
| PubChem CID | 22625486 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | tert-butyl (4-butylphenyl) carbonate |
| SMILES | CCCCc1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H22O3/c1-5-6-7-12-8-10-13(11-9-12)17-14(16)18-15(2,3)4/h8-11H,5-7H2,1-4H3 |
| InChIKey | GKULOKUDKOETNX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (4-butylphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (4-butylphenyl) carbonate?
The IUPAC name of tert-butyl (4-butylphenyl) carbonate (CID 22625486) is tert-butyl (4-butylphenyl) carbonate.
What is the SMILES notation for tert-butyl (4-butylphenyl) carbonate?
The canonical SMILES for tert-butyl (4-butylphenyl) carbonate is CCCCc1ccc(OC(=O)OC(C)(C)C)cc1.
What is the InChIKey of tert-butyl (4-butylphenyl) carbonate?
The InChIKey is GKULOKUDKOETNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O3/c1-5-6-7-12-8-10-13(11-9-12)17-14(16)18-15(2,3)4/h8-11H,5-7H2,1-4H3.
What are the key properties of tert-butyl (4-butylphenyl) carbonate?
tert-butyl (4-butylphenyl) carbonate has a molecular weight of 250.34 g/mol, XLogP of 4.34, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (4-butylphenyl) carbonate is sourced from PubChem (CID 22625486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).