C34H46O8 — CID 123447556
tert-butyl [4-[3-[5-[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propoxy]hexa-1,5-dien-2-yloxy]propyl]phenyl] carbonate (PubChem CID 123447556) has the molecular formula C34H46O8 and a molecular weight of 582.73 g/mol. Its IUPAC name is tert-butyl [4-[3-[5-[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propoxy]hexa-1,5-dien-2-yloxy]propyl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[3-[5-[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propoxy]hexa-1,5-dien-2-yloxy]propyl]phenyl] carbonate |
|---|---|
| PubChem CID | 123447556 |
| Molecular Formula | C34H46O8 |
| Molecular Weight | 582.73 g/mol |
| Exact Mass | 582.32 |
| IUPAC Name | tert-butyl [4-[3-[5-[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propoxy]hexa-1,5-dien-2-yloxy]propyl]phenyl] carbonate |
| SMILES | C=C(CCC(=C)OCCCc1ccc(OC(=O)OC(C)(C)C)cc1)OCCCc1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C34H46O8/c1-25(37-23-9-11-27-15-19-29(20-16-27)39-31(35)41-33(3,4)5)13-14-26(2)38-24-10-12-28-17-21-30(22-18-28)40-32(36)42-34(6,7)8/h15-22H,1-2,9-14,23-24H2,3-8H3 |
| InChIKey | RGURRNGBLAYAJK-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.73 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|