C40H58O10 — CID 144696874
bis[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propyl] 2-ethyl-3-propylcyclopropane-1,1-dicarboxylate;ethane (PubChem CID 144696874) has the molecular formula C40H58O10 and a molecular weight of 698.89 g/mol. Its IUPAC name is bis[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propyl] 2-ethyl-3-propylcyclopropane-1,1-dicarboxylate;ethane.
| Compound Name | bis[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propyl] 2-ethyl-3-propylcyclopropane-1,1-dicarboxylate;ethane |
|---|---|
| PubChem CID | 144696874 |
| Molecular Formula | C40H58O10 |
| Molecular Weight | 698.89 g/mol |
| Exact Mass | 698.40 |
| IUPAC Name | bis[3-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]propyl] 2-ethyl-3-propylcyclopropane-1,1-dicarboxylate;ethane |
| SMILES | CC.CCCC1C(CC)C1(C(=O)OCCCc1ccc(OC(=O)OC(C)(C)C)cc1)C(=O)OCCCc1ccc(OC(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C38H52O10.C2H6/c1-9-13-31-30(10-2)38(31,32(39)43-24-11-14-26-16-20-28(21-17-26)45-34(41)47-36(3,4)5)33(40)44-25-12-15-27-18-22-29(23-19-27)46-35(42)48-37(6,7)8;1-2/h16-23,30-31H,9-15,24-25H2,1-8H3;1-2H3 |
| InChIKey | SOPRDBZEKMINAY-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.89 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|