C38H50N2O10 — CID 122234965
bis[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl] 3,7-diazatricyclo[5.5.0.01,3]dodecane-2,2-dicarboxylate (PubChem CID 122234965) has the molecular formula C38H50N2O10 and a molecular weight of 694.82 g/mol. Its IUPAC name is bis[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl] 3,7-diazatricyclo[5.5.0.01,3]dodecane-2,2-dicarboxylate.
| Compound Name | bis[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl] 3,7-diazatricyclo[5.5.0.01,3]dodecane-2,2-dicarboxylate |
|---|---|
| PubChem CID | 122234965 |
| Molecular Formula | C38H50N2O10 |
| Molecular Weight | 694.82 g/mol |
| Exact Mass | 694.35 |
| IUPAC Name | bis[2-[4-[(2-methylpropan-2-yl)oxycarbonyloxy]phenyl]ethyl] 3,7-diazatricyclo[5.5.0.01,3]dodecane-2,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(CCOC(=O)C2(C(=O)OCCc3ccc(OC(=O)OC(C)(C)C)cc3)N3CCCN4CCCCCC432)cc1 |
| InChI | InChI=1S/C38H50N2O10/c1-35(2,3)49-33(43)47-29-15-11-27(12-16-29)19-25-45-31(41)38(37-21-8-7-9-22-39(37)23-10-24-40(37)38)32(42)46-26-20-28-13-17-30(18-14-28)48-34(44)50-36(4,5)6/h11-18H,7-10,19-26H2,1-6H3 |
| InChIKey | RRTIYSMOSGDGQS-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 129.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.82 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|