C19H27O4S+ — CID 23535053
tert-butyl [4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenyl] carbonate (PubChem CID 23535053) has the molecular formula C19H27O4S+ and a molecular weight of 351.49 g/mol. Its IUPAC name is tert-butyl [4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenyl] carbonate.
| Compound Name | tert-butyl [4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenyl] carbonate |
|---|---|
| PubChem CID | 23535053 |
| Molecular Formula | C19H27O4S+ |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl [4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenyl] carbonate |
| SMILES | CC(C)(C)OC(=O)Oc1ccc(C(=O)C(C)(C)[S+]2CCCC2)cc1 |
| InChI | InChI=1S/C19H27O4S/c1-18(2,3)23-17(21)22-15-10-8-14(9-11-15)16(20)19(4,5)24-12-6-7-13-24/h8-11H,6-7,12-13H2,1-5H3/q+1 |
| InChIKey | GOFZMQYBVMDVME-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|