C15H18F3NO6S3 — CID 140753383
[4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140753383) has the molecular formula C15H18F3NO6S3 and a molecular weight of 461.51 g/mol. Its IUPAC name is [4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140753383 |
| Molecular Formula | C15H18F3NO6S3 |
| Molecular Weight | 461.51 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | [4-[2-methyl-2-(thiolan-1-ium-1-yl)propanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CC(C)(C(=O)c1ccc(OS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1)[S+]1CCCC1 |
| InChI | InChI=1S/C15H18F3NO6S3/c1-14(2,26-9-3-4-10-26)13(20)11-5-7-12(8-6-11)25-28(23,24)19-27(21,22)15(16,17)18/h5-8H,3-4,9-10H2,1-2H3 |
| InChIKey | PYAHZFPAFNGILJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.51 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|