C17H22F3NO6S3 — CID 140753389
[4-[3,3-dimethyl-2-(thiolan-1-ium-1-yl)butanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140753389) has the molecular formula C17H22F3NO6S3 and a molecular weight of 489.56 g/mol. Its IUPAC name is [4-[3,3-dimethyl-2-(thiolan-1-ium-1-yl)butanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [4-[3,3-dimethyl-2-(thiolan-1-ium-1-yl)butanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140753389 |
| Molecular Formula | C17H22F3NO6S3 |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | [4-[3,3-dimethyl-2-(thiolan-1-ium-1-yl)butanoyl]phenoxy]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CC(C)(C)C(C(=O)c1ccc(OS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1)[S+]1CCCC1 |
| InChI | InChI=1S/C17H22F3NO6S3/c1-16(2,3)15(28-10-4-5-11-28)14(22)12-6-8-13(9-7-12)27-30(25,26)21-29(23,24)17(18,19)20/h6-9,15H,4-5,10-11H2,1-3H3 |
| InChIKey | XCMIHLMKBVTUFW-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|