C13H13F7NO7S3- — CID 58031038
[2-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 58031038) has the molecular formula C13H13F7NO7S3- and a molecular weight of 524.43 g/mol. Its IUPAC name is [2-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | [2-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 58031038 |
| Molecular Formula | C13H13F7NO7S3- |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.97 |
| IUPAC Name | [2-(4-butan-2-ylphenoxy)sulfonyl-1,1,2,2-tetrafluoroethyl]sulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | CCC(C)c1ccc(OS(=O)(=O)C(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H13F7NO7S3/c1-3-8(2)9-4-6-10(7-5-9)28-31(26,27)12(16,17)11(14,15)29(22,23)21-30(24,25)13(18,19)20/h4-8H,3H2,1-2H3/q-1 |
| InChIKey | GQMQFQMTJDAMKY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 125.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|