C21H26F3NO8S3 — CID 140753282
2-[5-(2-methoxyethoxy)-4-(thian-1-ium-1-yl)naphthalen-1-yl]oxyethoxysulfonyl-(trifluoromethylsulfonyl)azanide (PubChem CID 140753282) has the molecular formula C21H26F3NO8S3 and a molecular weight of 573.63 g/mol. Its IUPAC name is 2-[5-(2-methoxyethoxy)-4-(thian-1-ium-1-yl)naphthalen-1-yl]oxyethoxysulfonyl-(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-[5-(2-methoxyethoxy)-4-(thian-1-ium-1-yl)naphthalen-1-yl]oxyethoxysulfonyl-(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 140753282 |
| Molecular Formula | C21H26F3NO8S3 |
| Molecular Weight | 573.63 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 2-[5-(2-methoxyethoxy)-4-(thian-1-ium-1-yl)naphthalen-1-yl]oxyethoxysulfonyl-(trifluoromethylsulfonyl)azanide |
| SMILES | COCCOc1cccc2c(OCCOS(=O)(=O)[N-]S(=O)(=O)C(F)(F)F)ccc([S+]3CCCCC3)c12 |
| InChI | InChI=1S/C21H26F3NO8S3/c1-30-10-11-32-18-7-5-6-16-17(8-9-19(20(16)18)34-14-3-2-4-15-34)31-12-13-33-36(28,29)25-35(26,27)21(22,23)24/h5-9H,2-4,10-15H2,1H3 |
| InChIKey | FGMBPOGRZDRZIL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 119.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.63 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|