C25H27F3O4S2 — CID 162024596
1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(trifluoromethyl)benzenesulfonate (PubChem CID 162024596) has the molecular formula C25H27F3O4S2 and a molecular weight of 512.62 g/mol. Its IUPAC name is 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(trifluoromethyl)benzenesulfonate.
| Compound Name | 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(trifluoromethyl)benzenesulfonate |
|---|---|
| PubChem CID | 162024596 |
| Molecular Formula | C25H27F3O4S2 |
| Molecular Weight | 512.62 g/mol |
| Exact Mass | 512.13 |
| IUPAC Name | 1-(4-butoxynaphthalen-1-yl)thiolan-1-ium;2-(trifluoromethyl)benzenesulfonate |
| SMILES | CCCCOc1ccc([S+]2CCCC2)c2ccccc12.O=S(=O)([O-])c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H23OS.C7H5F3O3S/c1-2-3-12-19-17-10-11-18(20-13-6-7-14-20)16-9-5-4-8-15(16)17;8-7(9,10)5-3-1-2-4-6(5)14(11,12)13/h4-5,8-11H,2-3,6-7,12-14H2,1H3;1-4H,(H,11,12,13)/q+1;/p-1 |
| InChIKey | YVEWLJDFWQREKF-UHFFFAOYSA-M |
| XLogP | 6.40 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.62 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|