C21H30NO3S2+ — CID 144582668
4-butylsulfinyl-1-[4-(2-methoxyethoxy)naphthalen-1-yl]thiomorpholin-1-ium (PubChem CID 144582668) has the molecular formula C21H30NO3S2+ and a molecular weight of 408.61 g/mol. Its IUPAC name is 4-butylsulfinyl-1-[4-(2-methoxyethoxy)naphthalen-1-yl]thiomorpholin-1-ium.
| Compound Name | 4-butylsulfinyl-1-[4-(2-methoxyethoxy)naphthalen-1-yl]thiomorpholin-1-ium |
|---|---|
| PubChem CID | 144582668 |
| Molecular Formula | C21H30NO3S2+ |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.17 |
| IUPAC Name | 4-butylsulfinyl-1-[4-(2-methoxyethoxy)naphthalen-1-yl]thiomorpholin-1-ium |
| SMILES | CCCCS(=O)N1CC[S+](c2ccc(OCCOC)c3ccccc23)CC1 |
| InChI | InChI=1S/C21H30NO3S2/c1-3-4-15-27(23)22-11-16-26(17-12-22)21-10-9-20(25-14-13-24-2)18-7-5-6-8-19(18)21/h5-10H,3-4,11-17H2,1-2H3/q+1 |
| InChIKey | OADUHAWFHRKXNQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|